Busque entre los 166596 recursos disponibles en el repositorio
Mostrar el registro sencillo del ítem
dc.date.accessioned | 2020-09-14T15:04:34Z | |
dc.date.available | 2020-09-14T15:04:34Z | |
dc.date.issued | 2000 | |
dc.identifier.uri | http://sedici.unlp.edu.ar/handle/10915/104519 | |
dc.description.abstract | Dodecylnicotinate bis-adducts of binuclear copper carboxylates, of the general formula Cu2(O2CCn-1H2n-1)4(C5H4NCOOC12H25)2, were synthesized for n = 10, 12, 14, 16, 18 and 20, and their crystal structure, thermal behavior and magnetic properties studied. The molecular structure of the decyl derivative has been determined from single-crystal X-ray diffraction data. The dimer is centrosymmetric with the CuII ions in a square-pyramidal coordination with four O-alkyl O atoms [average d(Cu - O) 1.960 (6) Å] in the basal plane and the nicotine N atom at apical positions [d(Cu - N) 2.183 (3) Å]. The copper ions, 2.615 (1) Å apart, are bridged by four O-alkyl carboxylate groups. Both the n = 20 and n = 18 homologues exhibit lamellar phases, which can be related to the supramolecular arrangement found in the n = 10 derivative. The magnetic behavior of the decyl and octadecyl dimers was studied in the 2-300 K temperature range. They exhibit a strong intramolecular antiferromagnetic interaction (Cu-Cu superexchange coupling constant J = -347 cm-1 for the decyl derivative), which can be attributed to a large overlap of the metal 3d orbitals and the oxygen lone pair orbitals of the linking carboxylate groups. | en |
dc.format.extent | 666-672 | es |
dc.language | en | es |
dc.subject | tetrakis-μ-carboxylato-bis(dodecylnicotinato)dicopper(II) complexes | es |
dc.subject | magnetic properties | es |
dc.subject | decyl carboxylate derivative | es |
dc.subject | thermal properties | es |
dc.subject | binuclear dicopper carboxylates | es |
dc.title | Synthesis, structure and magnetic properties of tetrakis-μ-carboxylato-bis(dodecylnicotinato)dicopper(II) complexes; crystal and molecular structure of the decyl carboxylate derivative | en |
dc.type | Articulo | es |
sedici.identifier.uri | http://hdl.handle.net/11336/97273 | es |
sedici.identifier.uri | http://scripts.iucr.org/cgi-bin/paper?S0108768100002056 | es |
sedici.identifier.other | https://doi.org/10.1107/S0108768100002056 | es |
sedici.identifier.other | hdl:11336/97273 | es |
sedici.identifier.issn | 0108-7681 | es |
sedici.creator.person | Rusjan, Marcia | es |
sedici.creator.person | Chaia, Zulema | es |
sedici.creator.person | Piro, Oscar Enrique | es |
sedici.creator.person | Guillon, Daniel | es |
sedici.creator.person | Cukiernik, Fabio Daniel | es |
sedici.subject.materias | Ciencias Exactas | es |
sedici.subject.materias | Física | es |
sedici.description.fulltext | true | es |
mods.originInfo.place | Facultad de Ciencias Exactas | es |
mods.originInfo.place | Instituto de Física La Plata | es |
sedici.subtype | Articulo | es |
sedici.rights.license | Creative Commons Attribution 4.0 International (CC BY 4.0) | |
sedici.rights.uri | http://creativecommons.org/licenses/by/4.0/ | |
sedici.description.peerReview | peer-review | es |
sedici.relation.journalTitle | Acta Crystallographica Section B | es |
sedici.relation.journalVolumeAndIssue | vol. 56, no. 4 | es |